About dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate
dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate (PubChem CID 141496444) has the molecular formula C29H23F3O5
and a molecular weight of 508.49 g/mol. Its IUPAC name is dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate.
Molecular Properties
| Compound Name | dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate |
| PubChem CID | 141496444 |
| Molecular Formula | C29H23F3O5 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate |
| SMILES | O=Cc1ccc(C2C=C(C(F)(F)F)CC2(C(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H23F3O5/c30-29(31,32)24-15-25(23-13-11-20(17-33)12-14-23)28(16-24,26(34)36-18-21-7-3-1-4-8-21)27(35)37-19-22-9-5-2-6-10-22/h1-15,17,25H,16,18-19H2 |
| InChIKey | AIYBZRMVFVTRER-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate?
The IUPAC name of dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate (CID 141496444) is dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate.
What is the SMILES notation for dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate?
The canonical SMILES for dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate is O=Cc1ccc(C2C=C(C(F)(F)F)CC2(C(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cc1.
What is the InChIKey of dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate?
The InChIKey is AIYBZRMVFVTRER-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H23F3O5/c30-29(31,32)24-15-25(23-13-11-20(17-33)12-14-23)28(16-24,26(34)36-18-21-7-3-1-4-8-21)27(35)37-19-22-9-5-2-6-10-22/h1-15,17,25H,16,18-19H2.
What are the key properties of dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate?
dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate has a molecular weight of 508.49 g/mol, XLogP of 5.95, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl 2-(4-formylphenyl)-4-(trifluoromethyl)cyclopent-3-ene-1,1-dicarboxylate is sourced from PubChem (CID 141496444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).