C30H37F3N6O4 — CID 141496832
tert-butyl 4-[5-[[(5R,7S)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methyl]-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 141496832) has the molecular formula C30H37F3N6O4 and a molecular weight of 602.66 g/mol. Its IUPAC name is tert-butyl 4-[5-[[(5R,7S)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methyl]-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[[(5R,7S)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methyl]-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 141496832 |
| Molecular Formula | C30H37F3N6O4 |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | tert-butyl 4-[5-[[(5R,7S)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methyl]-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(Cc4ccc(N5CCN(C(=O)OC(C)(C)C)CC5)nc4)cc3N2)cc1OC |
| InChI | InChI=1S/C30H37F3N6O4/c1-29(2,3)43-28(40)38-12-10-37(11-13-38)26-9-6-19(18-34-26)14-21-16-27-35-22(17-25(30(31,32)33)39(27)36-21)20-7-8-23(41-4)24(15-20)42-5/h6-9,15-16,18,22,25,35H,10-14,17H2,1-5H3/t22-,25+/m1/s1 |
| InChIKey | IWJFBGYVYOGJIJ-RDGATRHJSA-N |
| XLogP | 5.60 |
| TPSA | 93.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |