C18H13NO4S — CID 141497225
7,17-dihydroxy-3-oxa-21-thia-13-azapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one (PubChem CID 141497225) has the molecular formula C18H13NO4S and a molecular weight of 339.37 g/mol. Its IUPAC name is 7,17-dihydroxy-3-oxa-21-thia-13-azapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one.
| Compound Name | 7,17-dihydroxy-3-oxa-21-thia-13-azapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one |
|---|---|
| PubChem CID | 141497225 |
| Molecular Formula | C18H13NO4S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 7,17-dihydroxy-3-oxa-21-thia-13-azapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-14-one |
| SMILES | O=C1c2cc(O)ccc2SC2c3oc4ccc(O)cc4c3CCN12 |
| InChI | InChI=1S/C18H13NO4S/c20-9-1-3-14-12(7-9)11-5-6-19-17(22)13-8-10(21)2-4-15(13)24-18(19)16(11)23-14/h1-4,7-8,18,20-21H,5-6H2 |
| InChIKey | RIECVNYYTDMAFF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |