C29H50O5Si — CID 141497835
trimethylsilyl (4R)-4-[(3R,5S,8R,9S,10S,13R,14S,17R)-3-(methoxymethoxy)-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 141497835) has the molecular formula C29H50O5Si and a molecular weight of 506.80 g/mol. Its IUPAC name is trimethylsilyl (4R)-4-[(3R,5S,8R,9S,10S,13R,14S,17R)-3-(methoxymethoxy)-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | trimethylsilyl (4R)-4-[(3R,5S,8R,9S,10S,13R,14S,17R)-3-(methoxymethoxy)-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 141497835 |
| Molecular Formula | C29H50O5Si |
| Molecular Weight | 506.80 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | trimethylsilyl (4R)-4-[(3R,5S,8R,9S,10S,13R,14S,17R)-3-(methoxymethoxy)-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COCO[C@@H]1CC[C@@]2(C)[C@H](CC(=O)[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CCC(=O)O[Si](C)(C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H50O5Si/c1-19(8-11-26(31)34-35(5,6)7)22-9-10-23-27-24(13-15-29(22,23)3)28(2)14-12-21(33-18-32-4)16-20(28)17-25(27)30/h19-24,27H,8-18H2,1-7H3/t19-,20+,21-,22-,23+,24+,27+,28+,29-/m1/s1 |
| InChIKey | GGYCQUKJFIDKHP-VDTQHDNYSA-N |
| XLogP | 6.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.80 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|