About 2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one
2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one (PubChem CID 141497950) has the molecular formula C25H16ClN3O2
and a molecular weight of 425.88 g/mol. Its IUPAC name is 2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one.
Molecular Properties
| Compound Name | 2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one |
| PubChem CID | 141497950 |
| Molecular Formula | C25H16ClN3O2 |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one |
| SMILES | O=c1c2cc(Cl)ccc2nc2n1-c1ccccc1C2(O)Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C25H16ClN3O2/c26-16-10-12-21-18(13-16)23(30)29-22-8-4-2-6-19(22)25(31,24(29)28-21)14-17-11-9-15-5-1-3-7-20(15)27-17/h1-13,31H,14H2 |
| InChIKey | INODZJOBIIIMHW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one?
The IUPAC name of 2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one (CID 141497950) is 2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one.
What is the SMILES notation for 2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one?
The canonical SMILES for 2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one is O=c1c2cc(Cl)ccc2nc2n1-c1ccccc1C2(O)Cc1ccc2ccccc2n1.
What is the InChIKey of 2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one?
The InChIKey is INODZJOBIIIMHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H16ClN3O2/c26-16-10-12-21-18(13-16)23(30)29-22-8-4-2-6-19(22)25(31,24(29)28-21)14-17-11-9-15-5-1-3-7-20(15)27-17/h1-13,31H,14H2.
What are the key properties of 2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one?
2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one has a molecular weight of 425.88 g/mol, XLogP of 4.38, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-hydroxy-6-(quinolin-2-ylmethyl)indolo[2,1-b]quinazolin-12-one is sourced from PubChem (CID 141497950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).