C32H37BBr2N2O4 — CID 141498218
N'-tert-butyl-4-(2,3-dibromophenyl)-N'-(3,5-dimethylbenzoyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide (PubChem CID 141498218) has the molecular formula C32H37BBr2N2O4 and a molecular weight of 684.28 g/mol. Its IUPAC name is N'-tert-butyl-4-(2,3-dibromophenyl)-N'-(3,5-dimethylbenzoyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide.
| Compound Name | N'-tert-butyl-4-(2,3-dibromophenyl)-N'-(3,5-dimethylbenzoyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 141498218 |
| Molecular Formula | C32H37BBr2N2O4 |
| Molecular Weight | 684.28 g/mol |
| Exact Mass | 682.12 |
| IUPAC Name | N'-tert-butyl-4-(2,3-dibromophenyl)-N'-(3,5-dimethylbenzoyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2ccc(-c3cccc(Br)c3Br)c(B3OC(C)(C)C(C)(C)O3)c2)C(C)(C)C)c1 |
| InChI | InChI=1S/C32H37BBr2N2O4/c1-19-15-20(2)17-22(16-19)29(39)37(30(3,4)5)36-28(38)21-13-14-23(24-11-10-12-26(34)27(24)35)25(18-21)33-40-31(6,7)32(8,9)41-33/h10-18H,1-9H3,(H,36,38) |
| InChIKey | YYPMMPOLNKHXKD-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.28 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|