C16H17FO8 — CID 141498913
trimethyl 4-(3-fluorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate (PubChem CID 141498913) has the molecular formula C16H17FO8 and a molecular weight of 356.30 g/mol. Its IUPAC name is trimethyl 4-(3-fluorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate.
| Compound Name | trimethyl 4-(3-fluorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 141498913 |
| Molecular Formula | C16H17FO8 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | trimethyl 4-(3-fluorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate |
| SMILES | COC(=O)CC(O)(C(=O)OC)C(C(=O)OC)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C16H17FO8/c1-23-11(18)8-16(22,15(21)25-3)12(14(20)24-2)13(19)9-5-4-6-10(17)7-9/h4-7,12,22H,8H2,1-3H3 |
| InChIKey | XLAGBJDZBMRJEQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|