C8H7F11O3 — CID 14149930
2-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethanol (PubChem CID 14149930) has the molecular formula C8H7F11O3 and a molecular weight of 360.12 g/mol. Its IUPAC name is 2-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethanol.
| Compound Name | 2-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethanol |
|---|---|
| PubChem CID | 14149930 |
| Molecular Formula | C8H7F11O3 |
| Molecular Weight | 360.12 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 2-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethanol |
| SMILES | OCCOCC(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H7F11O3/c9-4(6(12,13)14,3-21-2-1-20)22-8(18,19)5(10,11)7(15,16)17/h20H,1-3H2 |
| InChIKey | XMCTXRDKZGLQNU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.12 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|