C7H6F6O4 — CID 14149936
4-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,3-dioxolan-2-one (PubChem CID 14149936) has the molecular formula C7H6F6O4 and a molecular weight of 268.11 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 14149936 |
| Molecular Formula | C7H6F6O4 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(COC(C(F)(F)F)C(F)(F)F)O1 |
| InChI | InChI=1S/C7H6F6O4/c8-6(9,10)4(7(11,12)13)15-1-3-2-16-5(14)17-3/h3-4H,1-2H2 |
| InChIKey | QWSWYQWXNGQSIN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |