About (prop-2-enoylamino)methanesulfonate;rubidium(1+)
(prop-2-enoylamino)methanesulfonate;rubidium(1+) (PubChem CID 141499476) has the molecular formula C4H6NO4RbS
and a molecular weight of 249.63 g/mol. Its IUPAC name is (prop-2-enoylamino)methanesulfonate;rubidium(1+).
Molecular Properties
| Compound Name | (prop-2-enoylamino)methanesulfonate;rubidium(1+) |
| PubChem CID | 141499476 |
| Molecular Formula | C4H6NO4RbS |
| Molecular Weight | 249.63 g/mol |
| Exact Mass | 248.91 |
| IUPAC Name | (prop-2-enoylamino)methanesulfonate;rubidium(1+) |
| SMILES | C=CC(=O)NCS(=O)(=O)[O-].[Rb+] |
| InChI | InChI=1S/C4H7NO4S.Rb/c1-2-4(6)5-3-10(7,8)9;/h2H,1,3H2,(H,5,6)(H,7,8,9);/q;+1/p-1 |
| InChIKey | AKCKZUJGTBSAIO-UHFFFAOYSA-M |
| XLogP | -4.20 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.63 |
| LogP ≤ 5 | -4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (prop-2-enoylamino)methanesulfonate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (prop-2-enoylamino)methanesulfonate;rubidium(1+)?
The IUPAC name of (prop-2-enoylamino)methanesulfonate;rubidium(1+) (CID 141499476) is (prop-2-enoylamino)methanesulfonate;rubidium(1+).
What is the SMILES notation for (prop-2-enoylamino)methanesulfonate;rubidium(1+)?
The canonical SMILES for (prop-2-enoylamino)methanesulfonate;rubidium(1+) is C=CC(=O)NCS(=O)(=O)[O-].[Rb+].
What is the InChIKey of (prop-2-enoylamino)methanesulfonate;rubidium(1+)?
The InChIKey is AKCKZUJGTBSAIO-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H7NO4S.Rb/c1-2-4(6)5-3-10(7,8)9;/h2H,1,3H2,(H,5,6)(H,7,8,9);/q;+1/p-1.
What are the key properties of (prop-2-enoylamino)methanesulfonate;rubidium(1+)?
(prop-2-enoylamino)methanesulfonate;rubidium(1+) has a molecular weight of 249.63 g/mol, XLogP of -4.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (prop-2-enoylamino)methanesulfonate;rubidium(1+) is sourced from PubChem (CID 141499476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).