C18H20N4O2 — CID 14149948
2-[4-[2,3-dimethoxypropyl(ethyl)amino]phenyl]ethene-1,1,2-tricarbonitrile (PubChem CID 14149948) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[4-[2,3-dimethoxypropyl(ethyl)amino]phenyl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-[2,3-dimethoxypropyl(ethyl)amino]phenyl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 14149948 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-[4-[2,3-dimethoxypropyl(ethyl)amino]phenyl]ethene-1,1,2-tricarbonitrile |
| SMILES | CCN(CC(COC)OC)c1ccc(C(C#N)=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C18H20N4O2/c1-4-22(12-17(24-3)13-23-2)16-7-5-14(6-8-16)18(11-21)15(9-19)10-20/h5-8,17H,4,12-13H2,1-3H3 |
| InChIKey | GMKXKPCRJZGGFF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 93.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|