About disodium;2,2-di(decanoyl)-3-sulfobutanedioate
disodium;2,2-di(decanoyl)-3-sulfobutanedioate (PubChem CID 141499559) has the molecular formula C24H40Na2O9S
and a molecular weight of 550.62 g/mol. Its IUPAC name is disodium;2,2-di(decanoyl)-3-sulfobutanedioate.
Molecular Properties
| Compound Name | disodium;2,2-di(decanoyl)-3-sulfobutanedioate |
| PubChem CID | 141499559 |
| Molecular Formula | C24H40Na2O9S |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | disodium;2,2-di(decanoyl)-3-sulfobutanedioate |
| SMILES | CCCCCCCCCC(=O)C(C(=O)[O-])(C(=O)CCCCCCCCC)C(C(=O)[O-])S(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C24H42O9S.2Na/c1-3-5-7-9-11-13-15-17-19(25)24(23(29)30,21(22(27)28)34(31,32)33)20(26)18-16-14-12-10-8-6-4-2;;/h21H,3-18H2,1-2H3,(H,27,28)(H,29,30)(H,31,32,33);;/q;2*+1/p-2 |
| InChIKey | DWPMSPUNVVWYMD-UHFFFAOYSA-L |
| XLogP | -3.84 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;2,2-di(decanoyl)-3-sulfobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2,2-di(decanoyl)-3-sulfobutanedioate?
The IUPAC name of disodium;2,2-di(decanoyl)-3-sulfobutanedioate (CID 141499559) is disodium;2,2-di(decanoyl)-3-sulfobutanedioate.
What is the SMILES notation for disodium;2,2-di(decanoyl)-3-sulfobutanedioate?
The canonical SMILES for disodium;2,2-di(decanoyl)-3-sulfobutanedioate is CCCCCCCCCC(=O)C(C(=O)[O-])(C(=O)CCCCCCCCC)C(C(=O)[O-])S(=O)(=O)O.[Na+].[Na+].
What is the InChIKey of disodium;2,2-di(decanoyl)-3-sulfobutanedioate?
The InChIKey is DWPMSPUNVVWYMD-UHFFFAOYSA-L. The full InChI is InChI=1S/C24H42O9S.2Na/c1-3-5-7-9-11-13-15-17-19(25)24(23(29)30,21(22(27)28)34(31,32)33)20(26)18-16-14-12-10-8-6-4-2;;/h21H,3-18H2,1-2H3,(H,27,28)(H,29,30)(H,31,32,33);;/q;2*+1/p-2.
What are the key properties of disodium;2,2-di(decanoyl)-3-sulfobutanedioate?
disodium;2,2-di(decanoyl)-3-sulfobutanedioate has a molecular weight of 550.62 g/mol, XLogP of -3.84, 22 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2,2-di(decanoyl)-3-sulfobutanedioate is sourced from PubChem (CID 141499559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).