C22H25NO2S — CID 14149958
2-(4-isothiocyanatophenyl)-5-(4-pentylphenyl)-1,3-dioxane (PubChem CID 14149958) has the molecular formula C22H25NO2S and a molecular weight of 367.51 g/mol. Its IUPAC name is 2-(4-isothiocyanatophenyl)-5-(4-pentylphenyl)-1,3-dioxane.
| Compound Name | 2-(4-isothiocyanatophenyl)-5-(4-pentylphenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 14149958 |
| Molecular Formula | C22H25NO2S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-(4-isothiocyanatophenyl)-5-(4-pentylphenyl)-1,3-dioxane |
| SMILES | CCCCCc1ccc(C2COC(c3ccc(N=C=S)cc3)OC2)cc1 |
| InChI | InChI=1S/C22H25NO2S/c1-2-3-4-5-17-6-8-18(9-7-17)20-14-24-22(25-15-20)19-10-12-21(13-11-19)23-16-26/h6-13,20,22H,2-5,14-15H2,1H3 |
| InChIKey | JBYDNMITIWAMGD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|