About 1,1-diethoxyhexane-2,4-dione
1,1-diethoxyhexane-2,4-dione (PubChem CID 141499696) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 1,1-diethoxyhexane-2,4-dione.
Molecular Properties
| Compound Name | 1,1-diethoxyhexane-2,4-dione |
| PubChem CID | 141499696 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1,1-diethoxyhexane-2,4-dione |
| SMILES | CCOC(OCC)C(=O)CC(=O)CC |
| InChI | InChI=1S/C10H18O4/c1-4-8(11)7-9(12)10(13-5-2)14-6-3/h10H,4-7H2,1-3H3 |
| InChIKey | ZHNYVGXVRVRSMC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethoxyhexane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethoxyhexane-2,4-dione?
The IUPAC name of 1,1-diethoxyhexane-2,4-dione (CID 141499696) is 1,1-diethoxyhexane-2,4-dione.
What is the SMILES notation for 1,1-diethoxyhexane-2,4-dione?
The canonical SMILES for 1,1-diethoxyhexane-2,4-dione is CCOC(OCC)C(=O)CC(=O)CC.
What is the InChIKey of 1,1-diethoxyhexane-2,4-dione?
The InChIKey is ZHNYVGXVRVRSMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-4-8(11)7-9(12)10(13-5-2)14-6-3/h10H,4-7H2,1-3H3.
What are the key properties of 1,1-diethoxyhexane-2,4-dione?
1,1-diethoxyhexane-2,4-dione has a molecular weight of 202.25 g/mol, XLogP of 1.32, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethoxyhexane-2,4-dione is sourced from PubChem (CID 141499696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).