About 4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile
4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile (PubChem CID 14150484) has the molecular formula C10H6Cl2N2O2
and a molecular weight of 257.08 g/mol. Its IUPAC name is 4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile |
| PubChem CID | 14150484 |
| Molecular Formula | C10H6Cl2N2O2 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile |
| SMILES | COc1c(Cl)c(Cl)c(OC)c(C#N)c1C#N |
| InChI | InChI=1S/C10H6Cl2N2O2/c1-15-9-5(3-13)6(4-14)10(16-2)8(12)7(9)11/h1-2H3 |
| InChIKey | VSSYUYRLOZVIDZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile?
The IUPAC name of 4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile (CID 14150484) is 4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile?
The canonical SMILES for 4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile is COc1c(Cl)c(Cl)c(OC)c(C#N)c1C#N.
What is the InChIKey of 4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile?
The InChIKey is VSSYUYRLOZVIDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2N2O2/c1-15-9-5(3-13)6(4-14)10(16-2)8(12)7(9)11/h1-2H3.
What are the key properties of 4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile?
4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile has a molecular weight of 257.08 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-3,6-dimethoxybenzene-1,2-dicarbonitrile is sourced from PubChem (CID 14150484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).