C15H18N3O+ — CID 1415081
2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide (PubChem CID 1415081) has the molecular formula C15H18N3O+ and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide.
| Compound Name | 2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 1415081 |
| Molecular Formula | C15H18N3O+ |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide |
| SMILES | Cc1ccc(-c2c[n+](CC(N)=O)c3n2CCC3)cc1 |
| InChI | InChI=1S/C15H17N3O/c1-11-4-6-12(7-5-11)13-9-17(10-14(16)19)15-3-2-8-18(13)15/h4-7,9H,2-3,8,10H2,1H3,(H-,16,19)/p+1 |
| InChIKey | SDPJFHQBSLOWOV-UHFFFAOYSA-O |
| XLogP | 1.18 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|