About 1-(1,2,2-trifluoroethenoxy)propane
1-(1,2,2-trifluoroethenoxy)propane (PubChem CID 14151089) has the molecular formula C5H7F3O
and a molecular weight of 140.10 g/mol. Its IUPAC name is 1-(1,2,2-trifluoroethenoxy)propane.
Molecular Properties
| Compound Name | 1-(1,2,2-trifluoroethenoxy)propane |
| PubChem CID | 14151089 |
| Molecular Formula | C5H7F3O |
| Molecular Weight | 140.10 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | 1-(1,2,2-trifluoroethenoxy)propane |
| SMILES | CCCOC(F)=C(F)F |
| InChI | InChI=1S/C5H7F3O/c1-2-3-9-5(8)4(6)7/h2-3H2,1H3 |
| InChIKey | OYPIGFUBEOGSBR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.10 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2,2-trifluoroethenoxy)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,2-trifluoroethenoxy)propane?
The IUPAC name of 1-(1,2,2-trifluoroethenoxy)propane (CID 14151089) is 1-(1,2,2-trifluoroethenoxy)propane.
What is the SMILES notation for 1-(1,2,2-trifluoroethenoxy)propane?
The canonical SMILES for 1-(1,2,2-trifluoroethenoxy)propane is CCCOC(F)=C(F)F.
What is the InChIKey of 1-(1,2,2-trifluoroethenoxy)propane?
The InChIKey is OYPIGFUBEOGSBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F3O/c1-2-3-9-5(8)4(6)7/h2-3H2,1H3.
What are the key properties of 1-(1,2,2-trifluoroethenoxy)propane?
1-(1,2,2-trifluoroethenoxy)propane has a molecular weight of 140.10 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,2-trifluoroethenoxy)propane is sourced from PubChem (CID 14151089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).