About 4-hydroxy-1,3-dioxan-2-one
4-hydroxy-1,3-dioxan-2-one (PubChem CID 14151263) has the molecular formula C4H6O4
and a molecular weight of 118.09 g/mol. Its IUPAC name is 4-hydroxy-1,3-dioxan-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-1,3-dioxan-2-one |
| PubChem CID | 14151263 |
| Molecular Formula | C4H6O4 |
| Molecular Weight | 118.09 g/mol |
| Exact Mass | 118.03 |
| IUPAC Name | 4-hydroxy-1,3-dioxan-2-one |
| SMILES | O=C1OCCC(O)O1 |
| InChI | InChI=1S/C4H6O4/c5-3-1-2-7-4(6)8-3/h3,5H,1-2H2 |
| InChIKey | SFUJFSPYIQTVGJ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.09 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-1,3-dioxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1,3-dioxan-2-one?
The IUPAC name of 4-hydroxy-1,3-dioxan-2-one (CID 14151263) is 4-hydroxy-1,3-dioxan-2-one.
What is the SMILES notation for 4-hydroxy-1,3-dioxan-2-one?
The canonical SMILES for 4-hydroxy-1,3-dioxan-2-one is O=C1OCCC(O)O1.
What is the InChIKey of 4-hydroxy-1,3-dioxan-2-one?
The InChIKey is SFUJFSPYIQTVGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4/c5-3-1-2-7-4(6)8-3/h3,5H,1-2H2.
What are the key properties of 4-hydroxy-1,3-dioxan-2-one?
4-hydroxy-1,3-dioxan-2-one has a molecular weight of 118.09 g/mol, XLogP of -0.14, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1,3-dioxan-2-one is sourced from PubChem (CID 14151263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).