C15H21NO2 — CID 14151617
4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridin-10-ol (PubChem CID 14151617) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridin-10-ol.
| Compound Name | 4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridin-10-ol |
|---|---|
| PubChem CID | 14151617 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridin-10-ol |
| SMILES | CCCN1CCCC2c3c(O)cccc3OCC21 |
| InChI | InChI=1S/C15H21NO2/c1-2-8-16-9-4-5-11-12(16)10-18-14-7-3-6-13(17)15(11)14/h3,6-7,11-12,17H,2,4-5,8-10H2,1H3 |
| InChIKey | UKQPRJSOSVDGII-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |