C13H15NO2 — CID 14151698
4-methyl-2,3,4a,5-tetrahydrochromeno[3,4-b]pyridin-9-ol (PubChem CID 14151698) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 4-methyl-2,3,4a,5-tetrahydrochromeno[3,4-b]pyridin-9-ol.
| Compound Name | 4-methyl-2,3,4a,5-tetrahydrochromeno[3,4-b]pyridin-9-ol |
|---|---|
| PubChem CID | 14151698 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 4-methyl-2,3,4a,5-tetrahydrochromeno[3,4-b]pyridin-9-ol |
| SMILES | CN1CCC=C2c3cc(O)ccc3OCC21 |
| InChI | InChI=1S/C13H15NO2/c1-14-6-2-3-10-11-7-9(15)4-5-13(11)16-8-12(10)14/h3-5,7,12,15H,2,6,8H2,1H3 |
| InChIKey | BGBULBPIVTWFIU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |