About ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate
ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate (PubChem CID 14152126) has the molecular formula C14H18N6O6S2
and a molecular weight of 430.47 g/mol. Its IUPAC name is ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate |
| PubChem CID | 14152126 |
| Molecular Formula | C14H18N6O6S2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1S(=O)(=O)NC(=S)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C14H18N6O6S2/c1-5-26-12(21)8-7-15-20(2)11(8)28(22,23)19-14(27)18-13-16-9(24-3)6-10(17-13)25-4/h6-7H,5H2,1-4H3,(H2,16,17,18,19,27) |
| InChIKey | STYWXPSQLMGKAJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 146.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate?
The IUPAC name of ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate (CID 14152126) is ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate is CCOC(=O)c1cnn(C)c1S(=O)(=O)NC(=S)Nc1nc(OC)cc(OC)n1.
What is the InChIKey of ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate?
The InChIKey is STYWXPSQLMGKAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N6O6S2/c1-5-26-12(21)8-7-15-20(2)11(8)28(22,23)19-14(27)18-13-16-9(24-3)6-10(17-13)25-4/h6-7H,5H2,1-4H3,(H2,16,17,18,19,27).
What are the key properties of ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate?
ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate has a molecular weight of 430.47 g/mol, XLogP of 0.08, 7 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(4,6-dimethoxypyrimidin-2-yl)carbamothioylsulfamoyl]-1-methylpyrazole-4-carboxylate is sourced from PubChem (CID 14152126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).