C19H20N2O4 — CID 14152802
3-[4-[(3-ethyl-1-benzofuran-5-yl)oxy]phenyl]-1-methoxy-1-methylurea (PubChem CID 14152802) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-[4-[(3-ethyl-1-benzofuran-5-yl)oxy]phenyl]-1-methoxy-1-methylurea.
| Compound Name | 3-[4-[(3-ethyl-1-benzofuran-5-yl)oxy]phenyl]-1-methoxy-1-methylurea |
|---|---|
| PubChem CID | 14152802 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3-[4-[(3-ethyl-1-benzofuran-5-yl)oxy]phenyl]-1-methoxy-1-methylurea |
| SMILES | CCc1coc2ccc(Oc3ccc(NC(=O)N(C)OC)cc3)cc12 |
| InChI | InChI=1S/C19H20N2O4/c1-4-13-12-24-18-10-9-16(11-17(13)18)25-15-7-5-14(6-8-15)20-19(22)21(2)23-3/h5-12H,4H2,1-3H3,(H,20,22) |
| InChIKey | JULMMFMXKYDPMY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|