C13H20O5 — CID 14153440
ethyl 5,5-dimethoxy-2-oxo-1,3,3a,4,6,6a-hexahydropentalene-1-carboxylate (PubChem CID 14153440) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is ethyl 5,5-dimethoxy-2-oxo-1,3,3a,4,6,6a-hexahydropentalene-1-carboxylate.
| Compound Name | ethyl 5,5-dimethoxy-2-oxo-1,3,3a,4,6,6a-hexahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 14153440 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | ethyl 5,5-dimethoxy-2-oxo-1,3,3a,4,6,6a-hexahydropentalene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)CC2CC(OC)(OC)CC21 |
| InChI | InChI=1S/C13H20O5/c1-4-18-12(15)11-9-7-13(16-2,17-3)6-8(9)5-10(11)14/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | USXYUEWEVARGRJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|