About methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate
methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate (PubChem CID 14154178) has the molecular formula C9H12O3S
and a molecular weight of 200.26 g/mol. Its IUPAC name is methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate |
| PubChem CID | 14154178 |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(C)c(C)c1OC |
| InChI | InChI=1S/C9H12O3S/c1-5-6(2)13-8(7(5)11-3)9(10)12-4/h1-4H3 |
| InChIKey | SBNXOPZHUPAETG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate?
The IUPAC name of methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate (CID 14154178) is methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate.
What is the SMILES notation for methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate?
The canonical SMILES for methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate is COC(=O)c1sc(C)c(C)c1OC.
What is the InChIKey of methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate?
The InChIKey is SBNXOPZHUPAETG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3S/c1-5-6(2)13-8(7(5)11-3)9(10)12-4/h1-4H3.
What are the key properties of methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate?
methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate has a molecular weight of 200.26 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methoxy-4,5-dimethylthiophene-2-carboxylate is sourced from PubChem (CID 14154178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).