About 3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole
3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole (PubChem CID 14154373) has the molecular formula C20H19N3O3S2
and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole.
Molecular Properties
| Compound Name | 3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole |
| PubChem CID | 14154373 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole |
| SMILES | COc1ccc(Cn2c(S(=O)(=O)Cc3ccc(C)cn3)nc3cscc32)cc1 |
| InChI | InChI=1S/C20H19N3O3S2/c1-14-3-6-16(21-9-14)13-28(24,25)20-22-18-11-27-12-19(18)23(20)10-15-4-7-17(26-2)8-5-15/h3-9,11-12H,10,13H2,1-2H3 |
| InChIKey | HNPAZXJLLVWXEM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole?
The IUPAC name of 3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole (CID 14154373) is 3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole.
What is the SMILES notation for 3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole?
The canonical SMILES for 3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole is COc1ccc(Cn2c(S(=O)(=O)Cc3ccc(C)cn3)nc3cscc32)cc1.
What is the InChIKey of 3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole?
The InChIKey is HNPAZXJLLVWXEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O3S2/c1-14-3-6-16(21-9-14)13-28(24,25)20-22-18-11-27-12-19(18)23(20)10-15-4-7-17(26-2)8-5-15/h3-9,11-12H,10,13H2,1-2H3.
What are the key properties of 3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole?
3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole has a molecular weight of 413.52 g/mol, XLogP of 3.83, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methoxyphenyl)methyl]-2-[(5-methyl-2-pyridinyl)methylsulfonyl]thieno[3,4-d]imidazole is sourced from PubChem (CID 14154373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).