C14H13Cl2N5O2S — CID 14155220
N-(2,6-dichlorophenyl)-5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide (PubChem CID 14155220) has the molecular formula C14H13Cl2N5O2S and a molecular weight of 386.26 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide.
| Compound Name | N-(2,6-dichlorophenyl)-5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide |
|---|---|
| PubChem CID | 14155220 |
| Molecular Formula | C14H13Cl2N5O2S |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | N-(2,6-dichlorophenyl)-5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide |
| SMILES | Cc1nc2nc(S(=O)(=O)Nc3c(Cl)cccc3Cl)nn2c(C)c1C |
| InChI | InChI=1S/C14H13Cl2N5O2S/c1-7-8(2)17-13-18-14(19-21(13)9(7)3)24(22,23)20-12-10(15)5-4-6-11(12)16/h4-6,20H,1-3H3 |
| InChIKey | YIJBAGCLUOEESH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |