About ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate
ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate (PubChem CID 14155509) has the molecular formula C15H27BrO2S2
and a molecular weight of 383.42 g/mol. Its IUPAC name is ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate |
| PubChem CID | 14155509 |
| Molecular Formula | C15H27BrO2S2 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate |
| SMILES | CCOC(=O)C1(CCCCCCCCBr)SCCCS1 |
| InChI | InChI=1S/C15H27BrO2S2/c1-2-18-14(17)15(19-12-9-13-20-15)10-7-5-3-4-6-8-11-16/h2-13H2,1H3 |
| InChIKey | LUOFBMSRJXZZER-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate?
The IUPAC name of ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate (CID 14155509) is ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate.
What is the SMILES notation for ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate?
The canonical SMILES for ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate is CCOC(=O)C1(CCCCCCCCBr)SCCCS1.
What is the InChIKey of ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate?
The InChIKey is LUOFBMSRJXZZER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27BrO2S2/c1-2-18-14(17)15(19-12-9-13-20-15)10-7-5-3-4-6-8-11-16/h2-13H2,1H3.
What are the key properties of ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate?
ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate has a molecular weight of 383.42 g/mol, XLogP of 5.24, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(8-bromooctyl)-1,3-dithiane-2-carboxylate is sourced from PubChem (CID 14155509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).