About N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride
N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride (PubChem CID 14156) has the molecular formula C15H17ClN2O2
and a molecular weight of 292.77 g/mol. Its IUPAC name is N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride.
Molecular Properties
| Compound Name | N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride |
| PubChem CID | 14156 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride |
| SMILES | Cc1cc(C)[nH+]c(NC(=O)C(O)c2ccccc2)c1.[Cl-] |
| InChI | InChI=1S/C15H16N2O2.ClH/c1-10-8-11(2)16-13(9-10)17-15(19)14(18)12-6-4-3-5-7-12;/h3-9,14,18H,1-2H3,(H,16,17,19);1H |
| InChIKey | FBVZCGFKNFUCMS-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride?
The IUPAC name of N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride (CID 14156) is N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride.
What is the SMILES notation for N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride?
The canonical SMILES for N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride is Cc1cc(C)[nH+]c(NC(=O)C(O)c2ccccc2)c1.[Cl-].
What is the InChIKey of N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride?
The InChIKey is FBVZCGFKNFUCMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2.ClH/c1-10-8-11(2)16-13(9-10)17-15(19)14(18)12-6-4-3-5-7-12;/h3-9,14,18H,1-2H3,(H,16,17,19);1H.
What are the key properties of N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride?
N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride has a molecular weight of 292.77 g/mol, XLogP of -1.21, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethylpyridin-1-ium-2-yl)-2-hydroxy-2-phenylacetamide chloride is sourced from PubChem (CID 14156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).