C17H19N3 — CID 14156741
1-(1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-9-yl)-N-methylmethanamine (PubChem CID 14156741) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-(1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-9-yl)-N-methylmethanamine.
| Compound Name | 1-(1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-9-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 14156741 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 1-(1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-9-yl)-N-methylmethanamine |
| SMILES | CNCC1Nc2ccccc2N2CCc3cccc1c32 |
| InChI | InChI=1S/C17H19N3/c1-18-11-15-13-6-4-5-12-9-10-20(17(12)13)16-8-3-2-7-14(16)19-15/h2-8,15,18-19H,9-11H2,1H3 |
| InChIKey | JUZRCRSJGRYPMB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |