About 4-(hydroxymethyl)-1,3-dioxan-5-ol
4-(hydroxymethyl)-1,3-dioxan-5-ol (PubChem CID 14157568) has the molecular formula C5H10O4
and a molecular weight of 134.13 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1,3-dioxan-5-ol.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-1,3-dioxan-5-ol |
| PubChem CID | 14157568 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 4-(hydroxymethyl)-1,3-dioxan-5-ol |
| SMILES | OCC1OCOCC1O |
| InChI | InChI=1S/C5H10O4/c6-1-5-4(7)2-8-3-9-5/h4-7H,1-3H2 |
| InChIKey | VSHMUDKPBYKBPQ-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(hydroxymethyl)-1,3-dioxan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-1,3-dioxan-5-ol?
The IUPAC name of 4-(hydroxymethyl)-1,3-dioxan-5-ol (CID 14157568) is 4-(hydroxymethyl)-1,3-dioxan-5-ol.
What is the SMILES notation for 4-(hydroxymethyl)-1,3-dioxan-5-ol?
The canonical SMILES for 4-(hydroxymethyl)-1,3-dioxan-5-ol is OCC1OCOCC1O.
What is the InChIKey of 4-(hydroxymethyl)-1,3-dioxan-5-ol?
The InChIKey is VSHMUDKPBYKBPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O4/c6-1-5-4(7)2-8-3-9-5/h4-7H,1-3H2.
What are the key properties of 4-(hydroxymethyl)-1,3-dioxan-5-ol?
4-(hydroxymethyl)-1,3-dioxan-5-ol has a molecular weight of 134.13 g/mol, XLogP of -1.29, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-1,3-dioxan-5-ol is sourced from PubChem (CID 14157568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).