About [5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol
[5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol (PubChem CID 14157574) has the molecular formula C5H10O4
and a molecular weight of 134.13 g/mol. Its IUPAC name is [5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol.
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol |
| PubChem CID | 14157574 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | [5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol |
| SMILES | OCC1OCOC1CO |
| InChI | InChI=1S/C5H10O4/c6-1-4-5(2-7)9-3-8-4/h4-7H,1-3H2 |
| InChIKey | GURDVYADUQQTQV-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol?
The IUPAC name of [5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol (CID 14157574) is [5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol.
What is the SMILES notation for [5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol?
The canonical SMILES for [5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol is OCC1OCOC1CO.
What is the InChIKey of [5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol?
The InChIKey is GURDVYADUQQTQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O4/c6-1-4-5(2-7)9-3-8-4/h4-7H,1-3H2.
What are the key properties of [5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol?
[5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol has a molecular weight of 134.13 g/mol, XLogP of -1.29, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol is sourced from PubChem (CID 14157574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).