About 2-chloro-6-methyloxane
2-chloro-6-methyloxane (PubChem CID 14157727) has the molecular formula C6H11ClO
and a molecular weight of 134.61 g/mol. Its IUPAC name is 2-chloro-6-methyloxane.
Molecular Properties
| Compound Name | 2-chloro-6-methyloxane |
| PubChem CID | 14157727 |
| Molecular Formula | C6H11ClO |
| Molecular Weight | 134.61 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 2-chloro-6-methyloxane |
| SMILES | CC1CCCC(Cl)O1 |
| InChI | InChI=1S/C6H11ClO/c1-5-3-2-4-6(7)8-5/h5-6H,2-4H2,1H3 |
| InChIKey | SSPKFWFQDLPTQF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.61 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-methyloxane?
The IUPAC name of 2-chloro-6-methyloxane (CID 14157727) is 2-chloro-6-methyloxane.
What is the SMILES notation for 2-chloro-6-methyloxane?
The canonical SMILES for 2-chloro-6-methyloxane is CC1CCCC(Cl)O1.
What is the InChIKey of 2-chloro-6-methyloxane?
The InChIKey is SSPKFWFQDLPTQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClO/c1-5-3-2-4-6(7)8-5/h5-6H,2-4H2,1H3.
What are the key properties of 2-chloro-6-methyloxane?
2-chloro-6-methyloxane has a molecular weight of 134.61 g/mol, XLogP of 2.14, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-methyloxane is sourced from PubChem (CID 14157727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).