C11H22O5 — CID 14157735
(2R,3R,4R,5S,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-methyloxane (PubChem CID 14157735) has the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-methyloxane.
| Compound Name | (2R,3R,4R,5S,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-methyloxane |
|---|---|
| PubChem CID | 14157735 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (2R,3R,4R,5S,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-methyloxane |
| SMILES | COC[C@H]1O[C@H](C)[C@H](OC)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C11H22O5/c1-7-9(13-3)11(15-5)10(14-4)8(16-7)6-12-2/h7-11H,6H2,1-5H3/t7-,8-,9+,10-,11-/m1/s1 |
| InChIKey | MKCFMWMMGKZYHT-KAMPLNKDSA-N |
| XLogP | 0.47 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |