C22H28N2O9S — CID 14157963
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(benzylcarbamothioylamino)oxan-2-yl]methyl acetate (PubChem CID 14157963) has the molecular formula C22H28N2O9S and a molecular weight of 496.54 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(benzylcarbamothioylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(benzylcarbamothioylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14157963 |
| Molecular Formula | C22H28N2O9S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(benzylcarbamothioylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](NC(=S)NCc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H28N2O9S/c1-12(25)29-11-17-18(30-13(2)26)19(31-14(3)27)20(32-15(4)28)21(33-17)24-22(34)23-10-16-8-6-5-7-9-16/h5-9,17-21H,10-11H2,1-4H3,(H2,23,24,34)/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | VVSYQGBORQWETA-YMQHIKHWSA-N |
| XLogP | 0.73 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|