C56H68N4O4 — CID 14158381
5,11,17,23-tetrakis[[bis(prop-2-enyl)amino]methyl]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol (PubChem CID 14158381) has the molecular formula C56H68N4O4 and a molecular weight of 861.18 g/mol. Its IUPAC name is 5,11,17,23-tetrakis[[bis(prop-2-enyl)amino]methyl]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol.
| Compound Name | 5,11,17,23-tetrakis[[bis(prop-2-enyl)amino]methyl]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol |
|---|---|
| PubChem CID | 14158381 |
| Molecular Formula | C56H68N4O4 |
| Molecular Weight | 861.18 g/mol |
| Exact Mass | 860.52 |
| IUPAC Name | 5,11,17,23-tetrakis[[bis(prop-2-enyl)amino]methyl]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol |
| SMILES | C=CCN(CC=C)Cc1cc2c(O)c(c1)Cc1cc(CN(CC=C)CC=C)cc(c1O)Cc1cc(CN(CC=C)CC=C)cc(c1O)Cc1cc(CN(CC=C)CC=C)cc(c1O)C2 |
| InChI | InChI=1S/C56H68N4O4/c1-9-17-57(18-10-2)37-41-25-45-33-47-27-42(38-58(19-11-3)20-12-4)29-49(54(47)62)35-51-31-44(40-60(23-15-7)24-16-8)32-52(56(51)64)36-50-30-43(39-59(21-13-5)22-14-6)28-48(55(50)63)34-46(26-41)53(45)61/h9-16,25-32,61-64H,1-8,17-24,33-40H2 |
| InChIKey | AGXPKMMRESIJBO-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.18 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|