About 6-chloro-3,7-dimethyloct-7-en-1-ol
6-chloro-3,7-dimethyloct-7-en-1-ol (PubChem CID 14158831) has the molecular formula C10H19ClO
and a molecular weight of 190.71 g/mol. Its IUPAC name is 6-chloro-3,7-dimethyloct-7-en-1-ol.
Molecular Properties
| Compound Name | 6-chloro-3,7-dimethyloct-7-en-1-ol |
| PubChem CID | 14158831 |
| Molecular Formula | C10H19ClO |
| Molecular Weight | 190.71 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 6-chloro-3,7-dimethyloct-7-en-1-ol |
| SMILES | C=C(C)C(Cl)CCC(C)CCO |
| InChI | InChI=1S/C10H19ClO/c1-8(2)10(11)5-4-9(3)6-7-12/h9-10,12H,1,4-7H2,2-3H3 |
| InChIKey | VCRCEFSBDLQIOJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.71 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3,7-dimethyloct-7-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3,7-dimethyloct-7-en-1-ol?
The IUPAC name of 6-chloro-3,7-dimethyloct-7-en-1-ol (CID 14158831) is 6-chloro-3,7-dimethyloct-7-en-1-ol.
What is the SMILES notation for 6-chloro-3,7-dimethyloct-7-en-1-ol?
The canonical SMILES for 6-chloro-3,7-dimethyloct-7-en-1-ol is C=C(C)C(Cl)CCC(C)CCO.
What is the InChIKey of 6-chloro-3,7-dimethyloct-7-en-1-ol?
The InChIKey is VCRCEFSBDLQIOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19ClO/c1-8(2)10(11)5-4-9(3)6-7-12/h9-10,12H,1,4-7H2,2-3H3.
What are the key properties of 6-chloro-3,7-dimethyloct-7-en-1-ol?
6-chloro-3,7-dimethyloct-7-en-1-ol has a molecular weight of 190.71 g/mol, XLogP of 2.97, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3,7-dimethyloct-7-en-1-ol is sourced from PubChem (CID 14158831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).