C24H24O12 — CID 14159734
[6-[4-(3,4-dihydroxyphenyl)-7-methoxy-2-oxochromen-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate (PubChem CID 14159734) has the molecular formula C24H24O12 and a molecular weight of 504.44 g/mol. Its IUPAC name is [6-[4-(3,4-dihydroxyphenyl)-7-methoxy-2-oxochromen-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [6-[4-(3,4-dihydroxyphenyl)-7-methoxy-2-oxochromen-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14159734 |
| Molecular Formula | C24H24O12 |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | [6-[4-(3,4-dihydroxyphenyl)-7-methoxy-2-oxochromen-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
| SMILES | COc1cc(OC2OC(COC(C)=O)C(O)C(O)C2O)c2c(-c3ccc(O)c(O)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H24O12/c1-10(25)33-9-18-21(29)22(30)23(31)24(36-18)35-17-7-12(32-2)6-16-20(17)13(8-19(28)34-16)11-3-4-14(26)15(27)5-11/h3-8,18,21-24,26-27,29-31H,9H2,1-2H3 |
| InChIKey | IHKNBCYHNGYRCB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 185.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|