C34H58O11 — CID 14159796
3-(4,5-dihydroxy-3-methoxyoxan-2-yl)oxy-17-(7-hydroxy-6-methyl-5-methylideneheptan-2-yl)-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-4,6,8,15,16-pentol (PubChem CID 14159796) has the molecular formula C34H58O11 and a molecular weight of 642.83 g/mol. Its IUPAC name is 3-(4,5-dihydroxy-3-methoxyoxan-2-yl)oxy-17-(7-hydroxy-6-methyl-5-methylideneheptan-2-yl)-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-4,6,8,15,16-pentol.
| Compound Name | 3-(4,5-dihydroxy-3-methoxyoxan-2-yl)oxy-17-(7-hydroxy-6-methyl-5-methylideneheptan-2-yl)-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-4,6,8,15,16-pentol |
|---|---|
| PubChem CID | 14159796 |
| Molecular Formula | C34H58O11 |
| Molecular Weight | 642.83 g/mol |
| Exact Mass | 642.40 |
| IUPAC Name | 3-(4,5-dihydroxy-3-methoxyoxan-2-yl)oxy-17-(7-hydroxy-6-methyl-5-methylideneheptan-2-yl)-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-4,6,8,15,16-pentol |
| SMILES | C=C(CCC(C)C1C(O)C(O)C2C1(C)CCC1C3(C)CCC(OC4OCC(O)C(O)C4OC)C(O)C3C(O)CC12O)C(C)CO |
| InChI | InChI=1S/C34H58O11/c1-16(18(3)14-35)7-8-17(2)23-27(40)28(41)30-33(23,5)12-10-22-32(4)11-9-21(26(39)24(32)19(36)13-34(22,30)42)45-31-29(43-6)25(38)20(37)15-44-31/h17-31,35-42H,1,7-15H2,2-6H3 |
| InChIKey | NPTLRKRGQBZTCG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.83 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|