C13H16O4 — CID 14163740
2-(5,5-dimethyl-3-methylidene-2,6-dioxo-4,6a-dihydro-1H-pentalen-3a-yl)acetic acid (PubChem CID 14163740) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-(5,5-dimethyl-3-methylidene-2,6-dioxo-4,6a-dihydro-1H-pentalen-3a-yl)acetic acid.
| Compound Name | 2-(5,5-dimethyl-3-methylidene-2,6-dioxo-4,6a-dihydro-1H-pentalen-3a-yl)acetic acid |
|---|---|
| PubChem CID | 14163740 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-(5,5-dimethyl-3-methylidene-2,6-dioxo-4,6a-dihydro-1H-pentalen-3a-yl)acetic acid |
| SMILES | C=C1C(=O)CC2C(=O)C(C)(C)CC12CC(=O)O |
| InChI | InChI=1S/C13H16O4/c1-7-9(14)4-8-11(17)12(2,3)6-13(7,8)5-10(15)16/h8H,1,4-6H2,2-3H3,(H,15,16) |
| InChIKey | FVFBECXYRDMXCG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|