C24H39NO7 — CID 14163819
11-ethyl-6,18-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,7,8,16-tetrol (PubChem CID 14163819) has the molecular formula C24H39NO7 and a molecular weight of 453.58 g/mol. Its IUPAC name is 11-ethyl-6,18-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,7,8,16-tetrol.
| Compound Name | 11-ethyl-6,18-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,7,8,16-tetrol |
|---|---|
| PubChem CID | 14163819 |
| Molecular Formula | C24H39NO7 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 11-ethyl-6,18-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,7,8,16-tetrol |
| SMILES | CCN1CC2(COC)CCC(O)C34C5CC6C(O)C5C(O)(C(O)C6OC)C(C(OC)C23)C14 |
| InChI | InChI=1S/C24H39NO7/c1-5-25-9-22(10-30-2)7-6-13(26)23-12-8-11-16(27)14(12)24(29,21(28)17(11)31-3)15(20(23)25)18(32-4)19(22)23/h11-21,26-29H,5-10H2,1-4H3 |
| InChIKey | FPECZWKKKKZPPP-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |