C27H29NO6S — CID 14164226
[(2S,3R,4S)-4-cyano-1-(4-methoxyphenyl)-3,4-bis(phenylmethoxy)butan-2-yl] methanesulfonate (PubChem CID 14164226) has the molecular formula C27H29NO6S and a molecular weight of 495.60 g/mol. Its IUPAC name is [(2S,3R,4S)-4-cyano-1-(4-methoxyphenyl)-3,4-bis(phenylmethoxy)butan-2-yl] methanesulfonate.
| Compound Name | [(2S,3R,4S)-4-cyano-1-(4-methoxyphenyl)-3,4-bis(phenylmethoxy)butan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 14164226 |
| Molecular Formula | C27H29NO6S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | [(2S,3R,4S)-4-cyano-1-(4-methoxyphenyl)-3,4-bis(phenylmethoxy)butan-2-yl] methanesulfonate |
| SMILES | COc1ccc(C[C@H](OS(C)(=O)=O)[C@H](OCc2ccccc2)[C@H](C#N)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H29NO6S/c1-31-24-15-13-21(14-16-24)17-25(34-35(2,29)30)27(33-20-23-11-7-4-8-12-23)26(18-28)32-19-22-9-5-3-6-10-22/h3-16,25-27H,17,19-20H2,1-2H3/t25-,26-,27-/m0/s1 |
| InChIKey | SSGAUFFXNDLSQH-QKDODKLFSA-N |
| XLogP | 4.28 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|