C18H21N3O — CID 1416467
2-(4-ethylanilino)-7,7-dimethyl-6,8-dihydroquinazolin-5-one (PubChem CID 1416467) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 2-(4-ethylanilino)-7,7-dimethyl-6,8-dihydroquinazolin-5-one.
| Compound Name | 2-(4-ethylanilino)-7,7-dimethyl-6,8-dihydroquinazolin-5-one |
|---|---|
| PubChem CID | 1416467 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 2-(4-ethylanilino)-7,7-dimethyl-6,8-dihydroquinazolin-5-one |
| SMILES | CCc1ccc(Nc2ncc3c(n2)CC(C)(C)CC3=O)cc1 |
| InChI | InChI=1S/C18H21N3O/c1-4-12-5-7-13(8-6-12)20-17-19-11-14-15(21-17)9-18(2,3)10-16(14)22/h5-8,11H,4,9-10H2,1-3H3,(H,19,20,21) |
| InChIKey | OUWOUICAXVWGOV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |