C20H28O4 — CID 14164888
[(1S,3S,3aR,4S)-3-acetyl-7-methyl-6-oxo-4-propan-2-yl-1,2,3,3a,4,5-hexahydroinden-1-yl] (Z)-2-methylbut-2-enoate (PubChem CID 14164888) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is [(1S,3S,3aR,4S)-3-acetyl-7-methyl-6-oxo-4-propan-2-yl-1,2,3,3a,4,5-hexahydroinden-1-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S,3S,3aR,4S)-3-acetyl-7-methyl-6-oxo-4-propan-2-yl-1,2,3,3a,4,5-hexahydroinden-1-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 14164888 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [(1S,3S,3aR,4S)-3-acetyl-7-methyl-6-oxo-4-propan-2-yl-1,2,3,3a,4,5-hexahydroinden-1-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1C[C@H](C(C)=O)[C@@H]2C1=C(C)C(=O)C[C@H]2C(C)C |
| InChI | InChI=1S/C20H28O4/c1-7-11(4)20(23)24-17-9-15(13(6)21)19-14(10(2)3)8-16(22)12(5)18(17)19/h7,10,14-15,17,19H,8-9H2,1-6H3/b11-7-/t14-,15+,17-,19+/m0/s1 |
| InChIKey | RMJLOOWRYDCMMB-HVQJMJELSA-N |
| XLogP | 3.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|