C14H18O2 — CID 14164939
(4aR,7R,7aS)-4a,7,7a-trimethyl-5,6,7,8-tetrahydrocyclopenta[f][1]benzofuran-4-one (PubChem CID 14164939) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (4aR,7R,7aS)-4a,7,7a-trimethyl-5,6,7,8-tetrahydrocyclopenta[f][1]benzofuran-4-one.
| Compound Name | (4aR,7R,7aS)-4a,7,7a-trimethyl-5,6,7,8-tetrahydrocyclopenta[f][1]benzofuran-4-one |
|---|---|
| PubChem CID | 14164939 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (4aR,7R,7aS)-4a,7,7a-trimethyl-5,6,7,8-tetrahydrocyclopenta[f][1]benzofuran-4-one |
| SMILES | C[C@@H]1CC[C@@]2(C)C(=O)c3ccoc3C[C@@]12C |
| InChI | InChI=1S/C14H18O2/c1-9-4-6-13(2)12(15)10-5-7-16-11(10)8-14(9,13)3/h5,7,9H,4,6,8H2,1-3H3/t9-,13+,14+/m1/s1 |
| InChIKey | CSUSIQBEPMPDCP-IIMNLJJBSA-N |
| XLogP | 3.46 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |