About 3,5-dioxohexanenitrile
3,5-dioxohexanenitrile (PubChem CID 14165401) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is 3,5-dioxohexanenitrile.
Molecular Properties
| Compound Name | 3,5-dioxohexanenitrile |
| PubChem CID | 14165401 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | 3,5-dioxohexanenitrile |
| SMILES | CC(=O)CC(=O)CC#N |
| InChI | InChI=1S/C6H7NO2/c1-5(8)4-6(9)2-3-7/h2,4H2,1H3 |
| InChIKey | JXGITHNUJLZQOE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dioxohexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dioxohexanenitrile?
The IUPAC name of 3,5-dioxohexanenitrile (CID 14165401) is 3,5-dioxohexanenitrile.
What is the SMILES notation for 3,5-dioxohexanenitrile?
The canonical SMILES for 3,5-dioxohexanenitrile is CC(=O)CC(=O)CC#N.
What is the InChIKey of 3,5-dioxohexanenitrile?
The InChIKey is JXGITHNUJLZQOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2/c1-5(8)4-6(9)2-3-7/h2,4H2,1H3.
What are the key properties of 3,5-dioxohexanenitrile?
3,5-dioxohexanenitrile has a molecular weight of 125.13 g/mol, XLogP of 0.45, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dioxohexanenitrile is sourced from PubChem (CID 14165401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).