About 7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one
7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one (PubChem CID 14166104) has the molecular formula C15H15NO3
and a molecular weight of 257.29 g/mol. Its IUPAC name is 7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one.
Molecular Properties
| Compound Name | 7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one |
| PubChem CID | 14166104 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one |
| SMILES | COc1cccc2c3c(c(=O)[nH]c12)C=CC(C)(C)O3 |
| InChI | InChI=1S/C15H15NO3/c1-15(2)8-7-10-13(19-15)9-5-4-6-11(18-3)12(9)16-14(10)17/h4-8H,1-3H3,(H,16,17) |
| InChIKey | YBYSRJYNHOVUKM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one?
The IUPAC name of 7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one (CID 14166104) is 7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one.
What is the SMILES notation for 7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one?
The canonical SMILES for 7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one is COc1cccc2c3c(c(=O)[nH]c12)C=CC(C)(C)O3.
What is the InChIKey of 7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one?
The InChIKey is YBYSRJYNHOVUKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3/c1-15(2)8-7-10-13(19-15)9-5-4-6-11(18-3)12(9)16-14(10)17/h4-8H,1-3H3,(H,16,17).
What are the key properties of 7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one?
7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one has a molecular weight of 257.29 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one is sourced from PubChem (CID 14166104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).