C17H30O5 — CID 14166354
(1R)-1-[(2S,5R)-5-[(2S,5S,9R)-2,9-dimethyl-1,10-dioxaspiro[4.5]decan-2-yl]-2-methyloxolan-2-yl]ethane-1,2-diol (PubChem CID 14166354) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is (1R)-1-[(2S,5R)-5-[(2S,5S,9R)-2,9-dimethyl-1,10-dioxaspiro[4.5]decan-2-yl]-2-methyloxolan-2-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(2S,5R)-5-[(2S,5S,9R)-2,9-dimethyl-1,10-dioxaspiro[4.5]decan-2-yl]-2-methyloxolan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 14166354 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (1R)-1-[(2S,5R)-5-[(2S,5S,9R)-2,9-dimethyl-1,10-dioxaspiro[4.5]decan-2-yl]-2-methyloxolan-2-yl]ethane-1,2-diol |
| SMILES | C[C@@H]1CCC[C@]2(CC[C@@](C)([C@H]3CC[C@@](C)([C@H](O)CO)O3)O2)O1 |
| InChI | InChI=1S/C17H30O5/c1-12-5-4-7-17(20-12)10-9-16(3,22-17)14-6-8-15(2,21-14)13(19)11-18/h12-14,18-19H,4-11H2,1-3H3/t12-,13-,14-,15+,16+,17+/m1/s1 |
| InChIKey | XCALEKKNRIPROU-FFRIZKCHSA-N |
| XLogP | 2.13 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |