About N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide
N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide (PubChem CID 1416665) has the molecular formula C17H24N2O4S
and a molecular weight of 352.46 g/mol. Its IUPAC name is N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide.
Molecular Properties
| Compound Name | N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide |
| PubChem CID | 1416665 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)N2CCCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C17H24N2O4S/c1-21-13-10-12(11-14(22-2)15(13)23-3)16(20)18-17(24)19-8-6-4-5-7-9-19/h10-11H,4-9H2,1-3H3,(H,18,20,24) |
| InChIKey | YESSBBCWHQBYPF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide?
The IUPAC name of N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide (CID 1416665) is N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide.
What is the SMILES notation for N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide?
The canonical SMILES for N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide is COc1cc(C(=O)NC(=S)N2CCCCCC2)cc(OC)c1OC.
What is the InChIKey of N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide?
The InChIKey is YESSBBCWHQBYPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O4S/c1-21-13-10-12(11-14(22-2)15(13)23-3)16(20)18-17(24)19-8-6-4-5-7-9-19/h10-11H,4-9H2,1-3H3,(H,18,20,24).
What are the key properties of N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide?
N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide has a molecular weight of 352.46 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azepane-1-carbothioyl)-3,4,5-trimethoxybenzamide is sourced from PubChem (CID 1416665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).