C13H23O3P — CID 14167105
(1E,3E)-1-dimethoxyphosphoryl-4,8-dimethylnona-1,3,7-triene (PubChem CID 14167105) has the molecular formula C13H23O3P and a molecular weight of 258.30 g/mol. Its IUPAC name is (1E,3E)-1-dimethoxyphosphoryl-4,8-dimethylnona-1,3,7-triene.
| Compound Name | (1E,3E)-1-dimethoxyphosphoryl-4,8-dimethylnona-1,3,7-triene |
|---|---|
| PubChem CID | 14167105 |
| Molecular Formula | C13H23O3P |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (1E,3E)-1-dimethoxyphosphoryl-4,8-dimethylnona-1,3,7-triene |
| SMILES | COP(=O)(/C=C/C=C(\C)CCC=C(C)C)OC |
| InChI | InChI=1S/C13H23O3P/c1-12(2)8-6-9-13(3)10-7-11-17(14,15-4)16-5/h7-8,10-11H,6,9H2,1-5H3/b11-7+,13-10+ |
| InChIKey | QJWBWTHMFUVTLE-JPTKLRQTSA-N |
| XLogP | 4.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|