C12H22O5P2 — CID 14167123
[[(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 14167123) has the molecular formula C12H22O5P2 and a molecular weight of 308.25 g/mol. Its IUPAC name is [[(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 14167123 |
| Molecular Formula | C12H22O5P2 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | [[(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/C=C/P(=O)(O)CP(=O)(O)O |
| InChI | InChI=1S/C12H22O5P2/c1-11(2)6-4-7-12(3)8-5-9-18(13,14)10-19(15,16)17/h5-6,8-9H,4,7,10H2,1-3H3,(H,13,14)(H2,15,16,17)/b9-5+,12-8+ |
| InChIKey | LIXAIUGGGVDJPR-PIHCAMFYSA-N |
| XLogP | 3.60 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|